C32H38N2O5S — CID 131717668
methyl 2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylbutanoyl]amino]acetate (PubChem CID 131717668) has the molecular formula C32H38N2O5S and a molecular weight of 562.73 g/mol. Its IUPAC name is methyl 2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylbutanoyl]amino]acetate.
| Compound Name | methyl 2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylbutanoyl]amino]acetate |
|---|---|
| PubChem CID | 131717668 |
| Molecular Formula | C32H38N2O5S |
| Molecular Weight | 562.73 g/mol |
| Exact Mass | 562.25 |
| IUPAC Name | methyl 2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylbutanoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)[C@H](NC(=O)OC(C)(C)C)C(C)(C)SC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H38N2O5S/c1-30(2,3)39-29(37)34-27(28(36)33-22-26(35)38-6)31(4,5)40-32(23-16-10-7-11-17-23,24-18-12-8-13-19-24)25-20-14-9-15-21-25/h7-21,27H,22H2,1-6H3,(H,33,36)(H,34,37)/t27-/m0/s1 |
| InChIKey | VVXZBFGGIBHPNP-MHZLTWQESA-N |
| XLogP | 5.67 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.73 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|