C28H31Cl2NO4S — CID 174509557
dichloromethane;2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoic acid (PubChem CID 174509557) has the molecular formula C28H31Cl2NO4S and a molecular weight of 548.53 g/mol. Its IUPAC name is dichloromethane;2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoic acid.
| Compound Name | dichloromethane;2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 174509557 |
| Molecular Formula | C28H31Cl2NO4S |
| Molecular Weight | 548.53 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | dichloromethane;2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O.ClCCl |
| InChI | InChI=1S/C27H29NO4S.CH2Cl2/c1-26(2,3)32-25(31)28-23(24(29)30)19-33-27(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22;2-1-3/h4-18,23H,19H2,1-3H3,(H,28,31)(H,29,30);1H2 |
| InChIKey | WNGQLKAOQXXDLH-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.53 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|