C33H42N2O4S — CID 10347845
(2S,3S)-3-methyl-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropyl]amino]pentanoic acid (PubChem CID 10347845) has the molecular formula C33H42N2O4S and a molecular weight of 562.78 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropyl]amino]pentanoic acid.
| Compound Name | (2S,3S)-3-methyl-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 10347845 |
| Molecular Formula | C33H42N2O4S |
| Molecular Weight | 562.78 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | (2S,3S)-3-methyl-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropyl]amino]pentanoic acid |
| SMILES | CC[C@H](C)[C@H](NC[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C33H42N2O4S/c1-6-24(2)29(30(36)37)34-22-28(35-31(38)39-32(3,4)5)23-40-33(25-16-10-7-11-17-25,26-18-12-8-13-19-26)27-20-14-9-15-21-27/h7-21,24,28-29,34H,6,22-23H2,1-5H3,(H,35,38)(H,36,37)/t24-,28+,29-/m0/s1 |
| InChIKey | XBZXQYCCQILVRY-DOUMQJFESA-N |
| XLogP | 6.69 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.78 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|