C41H53N3O2S — CID 54371837
tert-butyl N-[(2R)-1-[[(2S)-3-methyl-1-(2-phenylethylamino)pentan-2-yl]amino]-3-tritylsulfanylpropan-2-yl]carbamate (PubChem CID 54371837) has the molecular formula C41H53N3O2S and a molecular weight of 651.96 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[[(2S)-3-methyl-1-(2-phenylethylamino)pentan-2-yl]amino]-3-tritylsulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[[(2S)-3-methyl-1-(2-phenylethylamino)pentan-2-yl]amino]-3-tritylsulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 54371837 |
| Molecular Formula | C41H53N3O2S |
| Molecular Weight | 651.96 g/mol |
| Exact Mass | 651.39 |
| IUPAC Name | tert-butyl N-[(2R)-1-[[(2S)-3-methyl-1-(2-phenylethylamino)pentan-2-yl]amino]-3-tritylsulfanylpropan-2-yl]carbamate |
| SMILES | CCC(C)[C@@H](CNCCc1ccccc1)NC[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C41H53N3O2S/c1-6-32(2)38(30-42-28-27-33-19-11-7-12-20-33)43-29-37(44-39(45)46-40(3,4)5)31-47-41(34-21-13-8-14-22-34,35-23-15-9-16-24-35)36-25-17-10-18-26-36/h7-26,32,37-38,42-43H,6,27-31H2,1-5H3,(H,44,45)/t32?,37-,38-/m1/s1 |
| InChIKey | UTTFDGNBEWCDAG-XTWLWDBKSA-N |
| XLogP | 8.44 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.96 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|