C42H49N3O6S2 — CID 18652271
(2S)-3-methyl-2-[[2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoyl]amino]-4-phenylbutanoyl]amino]-3-sulfanylbutanoic acid (PubChem CID 18652271) has the molecular formula C42H49N3O6S2 and a molecular weight of 756.00 g/mol. Its IUPAC name is (2S)-3-methyl-2-[[2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoyl]amino]-4-phenylbutanoyl]amino]-3-sulfanylbutanoic acid.
| Compound Name | (2S)-3-methyl-2-[[2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoyl]amino]-4-phenylbutanoyl]amino]-3-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 18652271 |
| Molecular Formula | C42H49N3O6S2 |
| Molecular Weight | 756.00 g/mol |
| Exact Mass | 755.31 |
| IUPAC Name | (2S)-3-methyl-2-[[2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoyl]amino]-4-phenylbutanoyl]amino]-3-sulfanylbutanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)NC(CCc1ccccc1)C(=O)N[C@@H](C(=O)O)C(C)(C)S |
| InChI | InChI=1S/C42H49N3O6S2/c1-40(2,3)51-39(50)44-34(28-53-42(30-20-12-7-13-21-30,31-22-14-8-15-23-31)32-24-16-9-17-25-32)37(47)43-33(27-26-29-18-10-6-11-19-29)36(46)45-35(38(48)49)41(4,5)52/h6-25,33-35,52H,26-28H2,1-5H3,(H,43,47)(H,44,50)(H,45,46)(H,48,49)/t33?,34-,35+/m1/s1 |
| InChIKey | UZTHFJRMWIHJMN-NZFROYLUSA-N |
| XLogP | 7.00 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.00 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|