C36H37ClN2O5S — CID 175713921
(2S)-2-[[(2S)-3-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-tritylsulfanylpropanoic acid (PubChem CID 175713921) has the molecular formula C36H37ClN2O5S and a molecular weight of 645.22 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-tritylsulfanylpropanoic acid.
| Compound Name | (2S)-2-[[(2S)-3-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-tritylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 175713921 |
| Molecular Formula | C36H37ClN2O5S |
| Molecular Weight | 645.22 g/mol |
| Exact Mass | 644.21 |
| IUPAC Name | (2S)-2-[[(2S)-3-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-tritylsulfanylpropanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(Cl)cc1)C(=O)N[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C36H37ClN2O5S/c1-35(2,3)44-34(43)39-30(23-25-19-21-29(37)22-20-25)32(40)38-31(33(41)42)24-45-36(26-13-7-4-8-14-26,27-15-9-5-10-16-27)28-17-11-6-12-18-28/h4-22,30-31H,23-24H2,1-3H3,(H,38,40)(H,39,43)(H,41,42)/t30-,31+/m0/s1 |
| InChIKey | YHCBGACUNWPIMU-IOWSJCHKSA-N |
| XLogP | 7.07 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.22 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|