C31H37NO4S — CID 140775252
ethyl (4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-tritylsulfanylpentanoate (PubChem CID 140775252) has the molecular formula C31H37NO4S and a molecular weight of 519.71 g/mol. Its IUPAC name is ethyl (4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-tritylsulfanylpentanoate.
| Compound Name | ethyl (4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-tritylsulfanylpentanoate |
|---|---|
| PubChem CID | 140775252 |
| Molecular Formula | C31H37NO4S |
| Molecular Weight | 519.71 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | ethyl (4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-tritylsulfanylpentanoate |
| SMILES | CCOC(=O)CC[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H37NO4S/c1-5-35-28(33)22-21-27(32-29(34)36-30(2,3)4)23-37-31(24-15-9-6-10-16-24,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-20,27H,5,21-23H2,1-4H3,(H,32,34)/t27-/m0/s1 |
| InChIKey | HCMWPNXRQDLBLK-MHZLTWQESA-N |
| XLogP | 6.95 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.71 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|