C33H41N2O4S+ — CID 57064795
(2R)-2-methyl-1-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropyl]pyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57064795) has the molecular formula C33H41N2O4S+ and a molecular weight of 561.77 g/mol. Its IUPAC name is (2R)-2-methyl-1-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropyl]pyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-2-methyl-1-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropyl]pyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57064795 |
| Molecular Formula | C33H41N2O4S+ |
| Molecular Weight | 561.77 g/mol |
| Exact Mass | 561.28 |
| IUPAC Name | (2R)-2-methyl-1-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropyl]pyrrolidin-1-ium-1-carboxylic acid |
| SMILES | C[C@@H]1CCC[N+]1(C[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C33H40N2O4S/c1-25-15-14-22-35(25,31(37)38)23-29(34-30(36)39-32(2,3)4)24-40-33(26-16-8-5-9-17-26,27-18-10-6-11-19-27)28-20-12-7-13-21-28/h5-13,16-21,25,29H,14-15,22-24H2,1-4H3,(H-,34,36,37,38)/p+1/t25-,29-,35?/m1/s1 |
| InChIKey | DRWHVQDZQJZAGT-MBIBALQZSA-O |
| XLogP | 7.28 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.77 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|