C44H49N3O4S — CID 18933001
methyl 1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropyl]-4-(naphthalen-1-ylmethyl)piperazine-2-carboxylate (PubChem CID 18933001) has the molecular formula C44H49N3O4S and a molecular weight of 715.96 g/mol. Its IUPAC name is methyl 1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropyl]-4-(naphthalen-1-ylmethyl)piperazine-2-carboxylate.
| Compound Name | methyl 1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropyl]-4-(naphthalen-1-ylmethyl)piperazine-2-carboxylate |
|---|---|
| PubChem CID | 18933001 |
| Molecular Formula | C44H49N3O4S |
| Molecular Weight | 715.96 g/mol |
| Exact Mass | 715.34 |
| IUPAC Name | methyl 1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropyl]-4-(naphthalen-1-ylmethyl)piperazine-2-carboxylate |
| SMILES | COC(=O)C1CN(Cc2cccc3ccccc23)CCN1CC(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C44H49N3O4S/c1-43(2,3)51-42(49)45-38(32-52-44(35-20-8-5-9-21-35,36-22-10-6-11-23-36)37-24-12-7-13-25-37)30-47-28-27-46(31-40(47)41(48)50-4)29-34-19-16-18-33-17-14-15-26-39(33)34/h5-26,38,40H,27-32H2,1-4H3,(H,45,49) |
| InChIKey | QKQAZQUNOOXKHH-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.96 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|