C47H53N3O4S — CID 67797247
tert-butyl N-[(2R)-1-[(2S)-2-(2-cyclopropyloxyethyl)-4-(naphthalene-1-carbonyl)piperazin-1-yl]-3-tritylsulfanylpropan-2-yl]carbamate (PubChem CID 67797247) has the molecular formula C47H53N3O4S and a molecular weight of 756.03 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[(2S)-2-(2-cyclopropyloxyethyl)-4-(naphthalene-1-carbonyl)piperazin-1-yl]-3-tritylsulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[(2S)-2-(2-cyclopropyloxyethyl)-4-(naphthalene-1-carbonyl)piperazin-1-yl]-3-tritylsulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 67797247 |
| Molecular Formula | C47H53N3O4S |
| Molecular Weight | 756.03 g/mol |
| Exact Mass | 755.38 |
| IUPAC Name | tert-butyl N-[(2R)-1-[(2S)-2-(2-cyclopropyloxyethyl)-4-(naphthalene-1-carbonyl)piperazin-1-yl]-3-tritylsulfanylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)CN1CCN(C(=O)c2cccc3ccccc23)C[C@@H]1CCOC1CC1 |
| InChI | InChI=1S/C47H53N3O4S/c1-46(2,3)54-45(52)48-39(34-55-47(36-18-7-4-8-19-36,37-20-9-5-10-21-37)38-22-11-6-12-23-38)32-49-29-30-50(33-40(49)28-31-53-41-26-27-41)44(51)43-25-15-17-35-16-13-14-24-42(35)43/h4-25,39-41H,26-34H2,1-3H3,(H,48,52)/t39-,40+/m1/s1 |
| InChIKey | LTODKXAJFRQHBO-PVXQIPPMSA-N |
| XLogP | 9.15 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.03 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|