C41H42N2O3S — CID 12966830
tert-butyl (2S)-4-(naphthalene-1-carbonyl)-2-(2-tritylsulfanylethyl)piperazine-1-carboxylate (PubChem CID 12966830) has the molecular formula C41H42N2O3S and a molecular weight of 642.87 g/mol. Its IUPAC name is tert-butyl (2S)-4-(naphthalene-1-carbonyl)-2-(2-tritylsulfanylethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-(naphthalene-1-carbonyl)-2-(2-tritylsulfanylethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 12966830 |
| Molecular Formula | C41H42N2O3S |
| Molecular Weight | 642.87 g/mol |
| Exact Mass | 642.29 |
| IUPAC Name | tert-butyl (2S)-4-(naphthalene-1-carbonyl)-2-(2-tritylsulfanylethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)c2cccc3ccccc23)C[C@@H]1CCSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H42N2O3S/c1-40(2,3)46-39(45)43-28-27-42(38(44)37-25-15-17-31-16-13-14-24-36(31)37)30-35(43)26-29-47-41(32-18-7-4-8-19-32,33-20-9-5-10-21-33)34-22-11-6-12-23-34/h4-25,35H,26-30H2,1-3H3/t35-/m0/s1 |
| InChIKey | PJSGJKNPVAZZBI-DHUJRADRSA-N |
| XLogP | 9.02 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.87 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|