C27H37N3O3 — CID 22941020
butyl 2-[[(2S)-2-butyl-4-(naphthalene-1-carbonyl)piperazin-1-yl]methyl]aziridine-1-carboxylate (PubChem CID 22941020) has the molecular formula C27H37N3O3 and a molecular weight of 451.61 g/mol. Its IUPAC name is butyl 2-[[(2S)-2-butyl-4-(naphthalene-1-carbonyl)piperazin-1-yl]methyl]aziridine-1-carboxylate.
| Compound Name | butyl 2-[[(2S)-2-butyl-4-(naphthalene-1-carbonyl)piperazin-1-yl]methyl]aziridine-1-carboxylate |
|---|---|
| PubChem CID | 22941020 |
| Molecular Formula | C27H37N3O3 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | butyl 2-[[(2S)-2-butyl-4-(naphthalene-1-carbonyl)piperazin-1-yl]methyl]aziridine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CC1CN1CCN(C(=O)c2cccc3ccccc23)C[C@@H]1CCCC |
| InChI | InChI=1S/C27H37N3O3/c1-3-5-12-22-18-29(26(31)25-14-9-11-21-10-7-8-13-24(21)25)16-15-28(22)19-23-20-30(23)27(32)33-17-6-4-2/h7-11,13-14,22-23H,3-6,12,15-20H2,1-2H3/t22-,23?,30?/m0/s1 |
| InChIKey | IBDXKWOEXZZKNA-QCBYUQAPSA-N |
| XLogP | 4.78 |
| TPSA | 52.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|