C24H30N4O — CID 15390969
[(3S)-3-butyl-4-[2-(1H-imidazol-5-yl)ethyl]piperazin-1-yl]-naphthalen-1-ylmethanone (PubChem CID 15390969) has the molecular formula C24H30N4O and a molecular weight of 390.53 g/mol. Its IUPAC name is [(3S)-3-butyl-4-[2-(1H-imidazol-5-yl)ethyl]piperazin-1-yl]-naphthalen-1-ylmethanone.
| Compound Name | [(3S)-3-butyl-4-[2-(1H-imidazol-5-yl)ethyl]piperazin-1-yl]-naphthalen-1-ylmethanone |
|---|---|
| PubChem CID | 15390969 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | [(3S)-3-butyl-4-[2-(1H-imidazol-5-yl)ethyl]piperazin-1-yl]-naphthalen-1-ylmethanone |
| SMILES | CCCC[C@H]1CN(C(=O)c2cccc3ccccc23)CCN1CCc1cnc[nH]1 |
| InChI | InChI=1S/C24H30N4O/c1-2-3-9-21-17-28(15-14-27(21)13-12-20-16-25-18-26-20)24(29)23-11-6-8-19-7-4-5-10-22(19)23/h4-8,10-11,16,18,21H,2-3,9,12-15,17H2,1H3,(H,25,26)/t21-/m0/s1 |
| InChIKey | KTLHLXSJEQRAKO-NRFANRHFSA-N |
| XLogP | 4.12 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |