C30H34N4O — CID 15390963
[(3S)-4-[(3-benzylimidazol-4-yl)methyl]-3-butylpiperazin-1-yl]-naphthalen-1-ylmethanone (PubChem CID 15390963) has the molecular formula C30H34N4O and a molecular weight of 466.63 g/mol. Its IUPAC name is [(3S)-4-[(3-benzylimidazol-4-yl)methyl]-3-butylpiperazin-1-yl]-naphthalen-1-ylmethanone.
| Compound Name | [(3S)-4-[(3-benzylimidazol-4-yl)methyl]-3-butylpiperazin-1-yl]-naphthalen-1-ylmethanone |
|---|---|
| PubChem CID | 15390963 |
| Molecular Formula | C30H34N4O |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | [(3S)-4-[(3-benzylimidazol-4-yl)methyl]-3-butylpiperazin-1-yl]-naphthalen-1-ylmethanone |
| SMILES | CCCC[C@H]1CN(C(=O)c2cccc3ccccc23)CCN1Cc1cncn1Cc1ccccc1 |
| InChI | InChI=1S/C30H34N4O/c1-2-3-14-26-21-33(30(35)29-16-9-13-25-12-7-8-15-28(25)29)18-17-32(26)22-27-19-31-23-34(27)20-24-10-5-4-6-11-24/h4-13,15-16,19,23,26H,2-3,14,17-18,20-22H2,1H3/t26-/m0/s1 |
| InChIKey | BVPFWVMLSPTNSG-SANMLTNESA-N |
| XLogP | 5.60 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |