C30H33N5O3 — CID 57273898
[3-butyl-4-[[5-[(4-nitrophenyl)methyl]-1H-imidazol-2-yl]methyl]piperazin-1-yl]-naphthalen-1-ylmethanone (PubChem CID 57273898) has the molecular formula C30H33N5O3 and a molecular weight of 511.63 g/mol. Its IUPAC name is [3-butyl-4-[[5-[(4-nitrophenyl)methyl]-1H-imidazol-2-yl]methyl]piperazin-1-yl]-naphthalen-1-ylmethanone.
| Compound Name | [3-butyl-4-[[5-[(4-nitrophenyl)methyl]-1H-imidazol-2-yl]methyl]piperazin-1-yl]-naphthalen-1-ylmethanone |
|---|---|
| PubChem CID | 57273898 |
| Molecular Formula | C30H33N5O3 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | [3-butyl-4-[[5-[(4-nitrophenyl)methyl]-1H-imidazol-2-yl]methyl]piperazin-1-yl]-naphthalen-1-ylmethanone |
| SMILES | CCCCC1CN(C(=O)c2cccc3ccccc23)CCN1Cc1ncc(Cc2ccc([N+](=O)[O-])cc2)[nH]1 |
| InChI | InChI=1S/C30H33N5O3/c1-2-3-9-26-20-34(30(36)28-11-6-8-23-7-4-5-10-27(23)28)17-16-33(26)21-29-31-19-24(32-29)18-22-12-14-25(15-13-22)35(37)38/h4-8,10-15,19,26H,2-3,9,16-18,20-21H2,1H3,(H,31,32) |
| InChIKey | WXYNYOKWGQNSJA-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 95.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|