C29H38Cl2N4O4 — CID 67589136
[(3S)-4-butan-2-yl-3-[(2R)-3-hydroxy-2-[(4-nitrophenyl)methylamino]propyl]piperazin-1-yl]-naphthalen-1-ylmethanone;dihydrochloride (PubChem CID 67589136) has the molecular formula C29H38Cl2N4O4 and a molecular weight of 577.55 g/mol. Its IUPAC name is [(3S)-4-butan-2-yl-3-[(2R)-3-hydroxy-2-[(4-nitrophenyl)methylamino]propyl]piperazin-1-yl]-naphthalen-1-ylmethanone;dihydrochloride.
| Compound Name | [(3S)-4-butan-2-yl-3-[(2R)-3-hydroxy-2-[(4-nitrophenyl)methylamino]propyl]piperazin-1-yl]-naphthalen-1-ylmethanone;dihydrochloride |
|---|---|
| PubChem CID | 67589136 |
| Molecular Formula | C29H38Cl2N4O4 |
| Molecular Weight | 577.55 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | [(3S)-4-butan-2-yl-3-[(2R)-3-hydroxy-2-[(4-nitrophenyl)methylamino]propyl]piperazin-1-yl]-naphthalen-1-ylmethanone;dihydrochloride |
| SMILES | CCC(C)N1CCN(C(=O)c2cccc3ccccc23)C[C@@H]1C[C@H](CO)NCc1ccc([N+](=O)[O-])cc1.Cl.Cl |
| InChI | InChI=1S/C29H36N4O4.2ClH/c1-3-21(2)32-16-15-31(29(35)28-10-6-8-23-7-4-5-9-27(23)28)19-26(32)17-24(20-34)30-18-22-11-13-25(14-12-22)33(36)37;;/h4-14,21,24,26,30,34H,3,15-20H2,1-2H3;2*1H/t21?,24-,26+;;/m1../s1 |
| InChIKey | CISMUEMTXYYHAX-SZJWURTPSA-N |
| XLogP | 5.06 |
| TPSA | 98.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|