C18H15NO7S — CID 157344982
naphthalene-1-carboxylic acid;(4-nitrophenyl)methanesulfonic acid (PubChem CID 157344982) has the molecular formula C18H15NO7S and a molecular weight of 389.39 g/mol. Its IUPAC name is naphthalene-1-carboxylic acid;(4-nitrophenyl)methanesulfonic acid.
| Compound Name | naphthalene-1-carboxylic acid;(4-nitrophenyl)methanesulfonic acid |
|---|---|
| PubChem CID | 157344982 |
| Molecular Formula | C18H15NO7S |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | naphthalene-1-carboxylic acid;(4-nitrophenyl)methanesulfonic acid |
| SMILES | O=C(O)c1cccc2ccccc12.O=[N+]([O-])c1ccc(CS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C11H8O2.C7H7NO5S/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10;9-8(10)7-3-1-6(2-4-7)5-14(11,12)13/h1-7H,(H,12,13);1-4H,5H2,(H,11,12,13) |
| InChIKey | BGVTUZLVGDETJF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 134.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|