C20H16N2O7S — CID 68507894
3-(naphthalen-1-ylsulfonylamino)-2-[(4-nitrophenyl)methyl]-3-oxopropanoic acid (PubChem CID 68507894) has the molecular formula C20H16N2O7S and a molecular weight of 428.42 g/mol. Its IUPAC name is 3-(naphthalen-1-ylsulfonylamino)-2-[(4-nitrophenyl)methyl]-3-oxopropanoic acid.
| Compound Name | 3-(naphthalen-1-ylsulfonylamino)-2-[(4-nitrophenyl)methyl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 68507894 |
| Molecular Formula | C20H16N2O7S |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 3-(naphthalen-1-ylsulfonylamino)-2-[(4-nitrophenyl)methyl]-3-oxopropanoic acid |
| SMILES | O=C(O)C(Cc1ccc([N+](=O)[O-])cc1)C(=O)NS(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H16N2O7S/c23-19(17(20(24)25)12-13-8-10-15(11-9-13)22(26)27)21-30(28,29)18-7-3-5-14-4-1-2-6-16(14)18/h1-11,17H,12H2,(H,21,23)(H,24,25) |
| InChIKey | VNLHNMMAVWPBAI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 143.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|