C27H25NO4S — CID 101179363
2-phenylethyl (2S)-2-(naphthalen-1-ylsulfonylamino)-3-phenylpropanoate (PubChem CID 101179363) has the molecular formula C27H25NO4S and a molecular weight of 459.57 g/mol. Its IUPAC name is 2-phenylethyl (2S)-2-(naphthalen-1-ylsulfonylamino)-3-phenylpropanoate.
| Compound Name | 2-phenylethyl (2S)-2-(naphthalen-1-ylsulfonylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 101179363 |
| Molecular Formula | C27H25NO4S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 2-phenylethyl (2S)-2-(naphthalen-1-ylsulfonylamino)-3-phenylpropanoate |
| SMILES | O=C(OCCc1ccccc1)[C@H](Cc1ccccc1)NS(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H25NO4S/c29-27(32-19-18-21-10-3-1-4-11-21)25(20-22-12-5-2-6-13-22)28-33(30,31)26-17-9-15-23-14-7-8-16-24(23)26/h1-17,25,28H,18-20H2/t25-/m0/s1 |
| InChIKey | KWALHPDQECZQNO-VWLOTQADSA-N |
| XLogP | 4.52 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |