C16H18N2O6S3 — CID 151966801
(2R)-2-amino-3-[[(2R)-2-carboxy-2-(naphthalen-1-ylsulfonylamino)ethyl]disulfanyl]propanoic acid (PubChem CID 151966801) has the molecular formula C16H18N2O6S3 and a molecular weight of 430.53 g/mol. Its IUPAC name is (2R)-2-amino-3-[[(2R)-2-carboxy-2-(naphthalen-1-ylsulfonylamino)ethyl]disulfanyl]propanoic acid.
| Compound Name | (2R)-2-amino-3-[[(2R)-2-carboxy-2-(naphthalen-1-ylsulfonylamino)ethyl]disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 151966801 |
| Molecular Formula | C16H18N2O6S3 |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | (2R)-2-amino-3-[[(2R)-2-carboxy-2-(naphthalen-1-ylsulfonylamino)ethyl]disulfanyl]propanoic acid |
| SMILES | N[C@@H](CSSC[C@H](NS(=O)(=O)c1cccc2ccccc12)C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H18N2O6S3/c17-12(15(19)20)8-25-26-9-13(16(21)22)18-27(23,24)14-7-3-5-10-4-1-2-6-11(10)14/h1-7,12-13,18H,8-9,17H2,(H,19,20)(H,21,22)/t12-,13-/m0/s1 |
| InChIKey | TZVINMQWKYDVBL-STQMWFEESA-N |
| XLogP | 1.36 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|