C19H20N2O4S — CID 122516263
(2S)-2-amino-3-phenylpropanoic acid;naphthalene-1-sulfonamide (PubChem CID 122516263) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is (2S)-2-amino-3-phenylpropanoic acid;naphthalene-1-sulfonamide.
| Compound Name | (2S)-2-amino-3-phenylpropanoic acid;naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 122516263 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | (2S)-2-amino-3-phenylpropanoic acid;naphthalene-1-sulfonamide |
| SMILES | NS(=O)(=O)c1cccc2ccccc12.N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C10H9NO2S.C9H11NO2/c11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10;10-8(9(11)12)6-7-4-2-1-3-5-7/h1-7H,(H2,11,12,13);1-5,8H,6,10H2,(H,11,12)/t;8-/m.0/s1 |
| InChIKey | IHTIDPSBUDTAKF-WDBKTSHHSA-N |
| XLogP | 2.13 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |