C6H12N2O6S4 — CID 87637300
2-amino-3-[[(2R)-2-carboxy-2-(hydroxysulfonothioylamino)ethyl]disulfanyl]propanoic acid (PubChem CID 87637300) has the molecular formula C6H12N2O6S4 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-amino-3-[[(2R)-2-carboxy-2-(hydroxysulfonothioylamino)ethyl]disulfanyl]propanoic acid.
| Compound Name | 2-amino-3-[[(2R)-2-carboxy-2-(hydroxysulfonothioylamino)ethyl]disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 87637300 |
| Molecular Formula | C6H12N2O6S4 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 335.96 |
| IUPAC Name | 2-amino-3-[[(2R)-2-carboxy-2-(hydroxysulfonothioylamino)ethyl]disulfanyl]propanoic acid |
| SMILES | NC(CSSC[C@H](NS(=O)(O)=S)C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H12N2O6S4/c7-3(5(9)10)1-16-17-2-4(6(11)12)8-18(13,14)15/h3-4,8H,1-2,7H2,(H,9,10)(H,11,12)(H,13,14,15)/t3?,4-/m0/s1 |
| InChIKey | SIRASOQMIVAWQS-BKLSDQPFSA-N |
| XLogP | -1.04 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|