C6H16Cl2N2O5S2 — CID 175225773
2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid;hydrate;dihydrochloride (PubChem CID 175225773) has the molecular formula C6H16Cl2N2O5S2 and a molecular weight of 331.24 g/mol. Its IUPAC name is 2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid;hydrate;dihydrochloride.
| Compound Name | 2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid;hydrate;dihydrochloride |
|---|---|
| PubChem CID | 175225773 |
| Molecular Formula | C6H16Cl2N2O5S2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid;hydrate;dihydrochloride |
| SMILES | Cl.Cl.NC(CSSCC(N)C(=O)O)C(=O)O.O |
| InChI | InChI=1S/C6H12N2O4S2.2ClH.H2O/c7-3(5(9)10)1-13-14-2-4(8)6(11)12;;;/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12);2*1H;1H2 |
| InChIKey | CGMIQHFHXGHSKJ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 158.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|