C6H11ClN2O3S2 — CID 142758437
(2R)-2-amino-3-[[(2S)-2-amino-3-chloro-3-oxopropyl]disulfanyl]propanoic acid (PubChem CID 142758437) has the molecular formula C6H11ClN2O3S2 and a molecular weight of 258.75 g/mol. Its IUPAC name is (2R)-2-amino-3-[[(2S)-2-amino-3-chloro-3-oxopropyl]disulfanyl]propanoic acid.
| Compound Name | (2R)-2-amino-3-[[(2S)-2-amino-3-chloro-3-oxopropyl]disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 142758437 |
| Molecular Formula | C6H11ClN2O3S2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | (2R)-2-amino-3-[[(2S)-2-amino-3-chloro-3-oxopropyl]disulfanyl]propanoic acid |
| SMILES | N[C@@H](CSSC[C@H](N)C(=O)Cl)C(=O)O |
| InChI | InChI=1S/C6H11ClN2O3S2/c7-5(10)3(8)1-13-14-2-4(9)6(11)12/h3-4H,1-2,8-9H2,(H,11,12)/t3-,4-/m0/s1 |
| InChIKey | SWVDNDRPYCGCFC-IMJSIDKUSA-N |
| XLogP | -0.13 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|