C6H14Li2N2O4S2 — CID 173165305
dilithium;2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid;hydride (PubChem CID 173165305) has the molecular formula C6H14Li2N2O4S2 and a molecular weight of 256.20 g/mol. Its IUPAC name is dilithium;2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid;hydride.
| Compound Name | dilithium;2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid;hydride |
|---|---|
| PubChem CID | 173165305 |
| Molecular Formula | C6H14Li2N2O4S2 |
| Molecular Weight | 256.20 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | dilithium;2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid;hydride |
| SMILES | NC(CSSCC(N)C(=O)O)C(=O)O.[H-].[H-].[Li+].[Li+] |
| InChI | InChI=1S/C6H12N2O4S2.2Li.2H/c7-3(5(9)10)1-13-14-2-4(8)6(11)12;;;;/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12);;;;/q;2*+1;2*-1 |
| InChIKey | STCQGULOGYGQHR-UHFFFAOYSA-N |
| XLogP | -6.58 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.20 |
| LogP ≤ 5 | -6.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|