C10H22N2O6S4 — CID 87643677
2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid;(2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol (PubChem CID 87643677) has the molecular formula C10H22N2O6S4 and a molecular weight of 394.56 g/mol. Its IUPAC name is 2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid;(2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol.
| Compound Name | 2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid;(2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol |
|---|---|
| PubChem CID | 87643677 |
| Molecular Formula | C10H22N2O6S4 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid;(2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol |
| SMILES | NC(CSSCC(N)C(=O)O)C(=O)O.O[C@H](CS)[C@H](O)CS |
| InChI | InChI=1S/C6H12N2O4S2.C4H10O2S2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12;5-3(1-7)4(6)2-8/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12);3-8H,1-2H2/t;3-,4-/m.1/s1 |
| InChIKey | NRZVPINYTZSYJR-WKUSAUFCSA-N |
| XLogP | -1.24 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|