C6H12CdN2O4S2 — CID 167531179
(2S)-2-amino-3-[[(2S)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;cadmium (PubChem CID 167531179) has the molecular formula C6H12CdN2O4S2 and a molecular weight of 352.72 g/mol. Its IUPAC name is (2S)-2-amino-3-[[(2S)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;cadmium.
| Compound Name | (2S)-2-amino-3-[[(2S)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;cadmium |
|---|---|
| PubChem CID | 167531179 |
| Molecular Formula | C6H12CdN2O4S2 |
| Molecular Weight | 352.72 g/mol |
| Exact Mass | 353.93 |
| IUPAC Name | (2S)-2-amino-3-[[(2S)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;cadmium |
| SMILES | N[C@H](CSSC[C@@H](N)C(=O)O)C(=O)O.[Cd] |
| InChI | InChI=1S/C6H12N2O4S2.Cd/c7-3(5(9)10)1-13-14-2-4(8)6(11)12;/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12);/t3-,4-;/m1./s1 |
| InChIKey | RNJOXGYRBFUQRB-VKKIDBQXSA-N |
| XLogP | -0.81 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.72 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|