C12H22N4O6S2 — CID 87270826
(2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;bis(prop-2-enamide) (PubChem CID 87270826) has the molecular formula C12H22N4O6S2 and a molecular weight of 382.46 g/mol. Its IUPAC name is (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;bis(prop-2-enamide).
| Compound Name | (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;bis(prop-2-enamide) |
|---|---|
| PubChem CID | 87270826 |
| Molecular Formula | C12H22N4O6S2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;bis(prop-2-enamide) |
| SMILES | C=CC(N)=O.C=CC(N)=O.N[C@@H](CSSC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H12N2O4S2.2C3H5NO/c7-3(5(9)10)1-13-14-2-4(8)6(11)12;2*1-2-3(4)5/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12);2*2H,1H2,(H2,4,5)/t3-,4-;;/m0../s1 |
| InChIKey | GVRRUSKBKXOYKB-RGVONZFCSA-N |
| XLogP | -1.49 |
| TPSA | 212.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|