C6H9NO3S — CID 135281345
2-amino-3-prop-2-enoylsulfanylpropanoic acid (PubChem CID 135281345) has the molecular formula C6H9NO3S and a molecular weight of 175.21 g/mol. Its IUPAC name is 2-amino-3-prop-2-enoylsulfanylpropanoic acid.
| Compound Name | 2-amino-3-prop-2-enoylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 135281345 |
| Molecular Formula | C6H9NO3S |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.03 |
| IUPAC Name | 2-amino-3-prop-2-enoylsulfanylpropanoic acid |
| SMILES | C=CC(=O)SCC(N)C(=O)O |
| InChI | InChI=1S/C6H9NO3S/c1-2-5(8)11-3-4(7)6(9)10/h2,4H,1,3,7H2,(H,9,10) |
| InChIKey | VHSFMYXALQLNBD-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|