C6H16N2O4S2Se2 — CID 174366423
(2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;selane (PubChem CID 174366423) has the molecular formula C6H16N2O4S2Se2 and a molecular weight of 402.26 g/mol. Its IUPAC name is (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;selane.
| Compound Name | (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;selane |
|---|---|
| PubChem CID | 174366423 |
| Molecular Formula | C6H16N2O4S2Se2 |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 403.89 |
| IUPAC Name | (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;selane |
| SMILES | N[C@@H](CSSC[C@H](N)C(=O)O)C(=O)O.[SeH2].[SeH2] |
| InChI | InChI=1S/C6H12N2O4S2.2H2Se/c7-3(5(9)10)1-13-14-2-4(8)6(11)12;;/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12);2*1H2/t3-,4-;;/m0../s1 |
| InChIKey | AIYPDMUKVVELOR-RGVONZFCSA-N |
| XLogP | -2.64 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|