C5H11NO2S2 — CID 46186615
(2S)-2-amino-3-(ethyldisulfanyl)propanoic acid (PubChem CID 46186615) has the molecular formula C5H11NO2S2 and a molecular weight of 181.28 g/mol. Its IUPAC name is (2S)-2-amino-3-(ethyldisulfanyl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(ethyldisulfanyl)propanoic acid |
|---|---|
| PubChem CID | 46186615 |
| Molecular Formula | C5H11NO2S2 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | (2S)-2-amino-3-(ethyldisulfanyl)propanoic acid |
| SMILES | CCSSC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C5H11NO2S2/c1-2-9-10-3-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m1/s1 |
| InChIKey | YIMFYOCZTDBZJL-SCSAIBSYSA-N |
| XLogP | 0.80 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|