C8H17NO2S2 — CID 3298047
2-amino-3-(pentyldisulfanyl)propanoic acid (PubChem CID 3298047) has the molecular formula C8H17NO2S2 and a molecular weight of 223.36 g/mol. Its IUPAC name is 2-amino-3-(pentyldisulfanyl)propanoic acid.
| Compound Name | 2-amino-3-(pentyldisulfanyl)propanoic acid |
|---|---|
| PubChem CID | 3298047 |
| Molecular Formula | C8H17NO2S2 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 2-amino-3-(pentyldisulfanyl)propanoic acid |
| SMILES | CCCCCSSCC(N)C(=O)O |
| InChI | InChI=1S/C8H17NO2S2/c1-2-3-4-5-12-13-6-7(9)8(10)11/h7H,2-6,9H2,1H3,(H,10,11) |
| InChIKey | QFYJSCJLKKAFDH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|