C8H16N2O4S2 — CID 11173218
2-amino-3-[(2-amino-3-ethoxy-3-oxopropyl)disulfanyl]propanoic acid (PubChem CID 11173218) has the molecular formula C8H16N2O4S2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-amino-3-[(2-amino-3-ethoxy-3-oxopropyl)disulfanyl]propanoic acid.
| Compound Name | 2-amino-3-[(2-amino-3-ethoxy-3-oxopropyl)disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 11173218 |
| Molecular Formula | C8H16N2O4S2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 2-amino-3-[(2-amino-3-ethoxy-3-oxopropyl)disulfanyl]propanoic acid |
| SMILES | CCOC(=O)C(N)CSSCC(N)C(=O)O |
| InChI | InChI=1S/C8H16N2O4S2/c1-2-14-8(13)6(10)4-16-15-3-5(9)7(11)12/h5-6H,2-4,9-10H2,1H3,(H,11,12) |
| InChIKey | KAIKQIDEYPTJRX-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|