C8H14N2O5S2 — CID 166520094
(2R)-3-[[(2R)-3-acetyloxy-2-amino-3-oxopropyl]disulfanyl]-2-aminopropanoic acid (PubChem CID 166520094) has the molecular formula C8H14N2O5S2 and a molecular weight of 282.34 g/mol. Its IUPAC name is (2R)-3-[[(2R)-3-acetyloxy-2-amino-3-oxopropyl]disulfanyl]-2-aminopropanoic acid.
| Compound Name | (2R)-3-[[(2R)-3-acetyloxy-2-amino-3-oxopropyl]disulfanyl]-2-aminopropanoic acid |
|---|---|
| PubChem CID | 166520094 |
| Molecular Formula | C8H14N2O5S2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | (2R)-3-[[(2R)-3-acetyloxy-2-amino-3-oxopropyl]disulfanyl]-2-aminopropanoic acid |
| SMILES | CC(=O)OC(=O)[C@@H](N)CSSC[C@H](N)C(=O)O |
| InChI | InChI=1S/C8H14N2O5S2/c1-4(11)15-8(14)6(10)3-17-16-2-5(9)7(12)13/h5-6H,2-3,9-10H2,1H3,(H,12,13)/t5-,6-/m0/s1 |
| InChIKey | CJAAXLDOEPCBOL-WDSKDSINSA-N |
| XLogP | -0.80 |
| TPSA | 132.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|