C6H15ClN2O5S2 — CID 57364743
(2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;hydrate;hydrochloride (PubChem CID 57364743) has the molecular formula C6H15ClN2O5S2 and a molecular weight of 294.78 g/mol. Its IUPAC name is (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;hydrate;hydrochloride.
| Compound Name | (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;hydrate;hydrochloride |
|---|---|
| PubChem CID | 57364743 |
| Molecular Formula | C6H15ClN2O5S2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;hydrate;hydrochloride |
| SMILES | Cl.N[C@@H](CSSC[C@H](N)C(=O)O)C(=O)O.O |
| InChI | InChI=1S/C6H12N2O4S2.ClH.H2O/c7-3(5(9)10)1-13-14-2-4(8)6(11)12;;/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12);1H;1H2/t3-,4-;;/m0../s1 |
| InChIKey | QJNZULMKATYHDA-RGVONZFCSA-N |
| XLogP | -1.21 |
| TPSA | 158.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|