C3H7NO2S3 — CID 137350062
(2R)-2-amino-3-(trisulfanyl)propanoic acid (PubChem CID 137350062) has the molecular formula C3H7NO2S3 and a molecular weight of 185.29 g/mol. Its IUPAC name is (2R)-2-amino-3-(trisulfanyl)propanoic acid.
| Compound Name | (2R)-2-amino-3-(trisulfanyl)propanoic acid |
|---|---|
| PubChem CID | 137350062 |
| Molecular Formula | C3H7NO2S3 |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 184.96 |
| IUPAC Name | (2R)-2-amino-3-(trisulfanyl)propanoic acid |
| SMILES | N[C@@H](CSSS)C(=O)O |
| InChI | InChI=1S/C3H7NO2S3/c4-2(3(5)6)1-8-9-7/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1 |
| InChIKey | WBUQYANSBCOQMP-REOHCLBHSA-N |
| XLogP | 0.62 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|