C7H15NO4S3 — CID 137348538
(2R)-2-amino-3-[[(2S,3S)-2,3-dihydroxy-4-sulfanylbutyl]disulfanyl]propanoic acid (PubChem CID 137348538) has the molecular formula C7H15NO4S3 and a molecular weight of 273.40 g/mol. Its IUPAC name is (2R)-2-amino-3-[[(2S,3S)-2,3-dihydroxy-4-sulfanylbutyl]disulfanyl]propanoic acid.
| Compound Name | (2R)-2-amino-3-[[(2S,3S)-2,3-dihydroxy-4-sulfanylbutyl]disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 137348538 |
| Molecular Formula | C7H15NO4S3 |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | (2R)-2-amino-3-[[(2S,3S)-2,3-dihydroxy-4-sulfanylbutyl]disulfanyl]propanoic acid |
| SMILES | N[C@@H](CSSC[C@@H](O)[C@H](O)CS)C(=O)O |
| InChI | InChI=1S/C7H15NO4S3/c8-4(7(11)12)2-14-15-3-6(10)5(9)1-13/h4-6,9-10,13H,1-3,8H2,(H,11,12)/t4-,5+,6+/m0/s1 |
| InChIKey | CWMXJTTVAJOZEM-KVQBGUIXSA-N |
| XLogP | -0.57 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|