C18H37N5O10S5 — CID 159528791
2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid;3-[[2-carboxy-2-(methylamino)ethyl]disulfanyl]-2-(methylamino)propanoic acid;2-(methylamino)-3-sulfanylpropanoic acid (PubChem CID 159528791) has the molecular formula C18H37N5O10S5 and a molecular weight of 643.85 g/mol. Its IUPAC name is 2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid;3-[[2-carboxy-2-(methylamino)ethyl]disulfanyl]-2-(methylamino)propanoic acid;2-(methylamino)-3-sulfanylpropanoic acid.
| Compound Name | 2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid;3-[[2-carboxy-2-(methylamino)ethyl]disulfanyl]-2-(methylamino)propanoic acid;2-(methylamino)-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 159528791 |
| Molecular Formula | C18H37N5O10S5 |
| Molecular Weight | 643.85 g/mol |
| Exact Mass | 643.11 |
| IUPAC Name | 2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid;3-[[2-carboxy-2-(methylamino)ethyl]disulfanyl]-2-(methylamino)propanoic acid;2-(methylamino)-3-sulfanylpropanoic acid |
| SMILES | CNC(CS)C(=O)O.CNC(CSSCC(NC)C(=O)O)C(=O)O.NC(CSSCC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H16N2O4S2.C6H12N2O4S2.C4H9NO2S/c1-9-5(7(11)12)3-15-16-4-6(10-2)8(13)14;7-3(5(9)10)1-13-14-2-4(8)6(11)12;1-5-3(2-8)4(6)7/h5-6,9-10H,3-4H2,1-2H3,(H,11,12)(H,13,14);3-4H,1-2,7-8H2,(H,9,10)(H,11,12);3,5,8H,2H2,1H3,(H,6,7) |
| InChIKey | MCSNAUGSYHTZQD-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 274.63 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.85 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|