C6H11ClN2O4S2 — CID 21490626
2-amino-3-[[2-carboxy-2-(chloroamino)ethyl]disulfanyl]propanoic acid (PubChem CID 21490626) has the molecular formula C6H11ClN2O4S2 and a molecular weight of 274.75 g/mol. Its IUPAC name is 2-amino-3-[[2-carboxy-2-(chloroamino)ethyl]disulfanyl]propanoic acid.
| Compound Name | 2-amino-3-[[2-carboxy-2-(chloroamino)ethyl]disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 21490626 |
| Molecular Formula | C6H11ClN2O4S2 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | 2-amino-3-[[2-carboxy-2-(chloroamino)ethyl]disulfanyl]propanoic acid |
| SMILES | NC(CSSCC(NCl)C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H11ClN2O4S2/c7-9-4(6(12)13)2-15-14-1-3(8)5(10)11/h3-4,9H,1-2,8H2,(H,10,11)(H,12,13) |
| InChIKey | FGBFBQULHKUDQV-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|