C8H18N2O2S2 — CID 165172984
2-amino-3-[(2-amino-3-methylbutyl)disulfanyl]propanoic acid (PubChem CID 165172984) has the molecular formula C8H18N2O2S2 and a molecular weight of 238.38 g/mol. Its IUPAC name is 2-amino-3-[(2-amino-3-methylbutyl)disulfanyl]propanoic acid.
| Compound Name | 2-amino-3-[(2-amino-3-methylbutyl)disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 165172984 |
| Molecular Formula | C8H18N2O2S2 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-amino-3-[(2-amino-3-methylbutyl)disulfanyl]propanoic acid |
| SMILES | CC(C)C(N)CSSCC(N)C(=O)O |
| InChI | InChI=1S/C8H18N2O2S2/c1-5(2)6(9)3-13-14-4-7(10)8(11)12/h5-7H,3-4,9-10H2,1-2H3,(H,11,12) |
| InChIKey | FUCFJPQMSSCCSX-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|