C12H24N4O7S2 — CID 161333292
(2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;2-aminopropanoyl 2-aminopropanoate (PubChem CID 161333292) has the molecular formula C12H24N4O7S2 and a molecular weight of 400.48 g/mol. Its IUPAC name is (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;2-aminopropanoyl 2-aminopropanoate.
| Compound Name | (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;2-aminopropanoyl 2-aminopropanoate |
|---|---|
| PubChem CID | 161333292 |
| Molecular Formula | C12H24N4O7S2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;2-aminopropanoyl 2-aminopropanoate |
| SMILES | CC(N)C(=O)OC(=O)C(C)N.N[C@@H](CSSC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H12N2O4S2.C6H12N2O3/c7-3(5(9)10)1-13-14-2-4(8)6(11)12;1-3(7)5(9)11-6(10)4(2)8/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12);3-4H,7-8H2,1-2H3/t3-,4-;/m0./s1 |
| InChIKey | VLRWPNSFFZMJHJ-MMALYQPHSA-N |
| XLogP | -2.06 |
| TPSA | 222.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|