C8H17N3O4S2 — CID 88520758
(2S)-2-amino-3-[[(2R)-2-amino-3-(2-aminoethoxy)-3-oxopropyl]disulfanyl]propanoic acid (PubChem CID 88520758) has the molecular formula C8H17N3O4S2 and a molecular weight of 283.38 g/mol. Its IUPAC name is (2S)-2-amino-3-[[(2R)-2-amino-3-(2-aminoethoxy)-3-oxopropyl]disulfanyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[[(2R)-2-amino-3-(2-aminoethoxy)-3-oxopropyl]disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 88520758 |
| Molecular Formula | C8H17N3O4S2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | (2S)-2-amino-3-[[(2R)-2-amino-3-(2-aminoethoxy)-3-oxopropyl]disulfanyl]propanoic acid |
| SMILES | NCCOC(=O)[C@@H](N)CSSC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C8H17N3O4S2/c9-1-2-15-8(14)6(11)4-17-16-3-5(10)7(12)13/h5-6H,1-4,9-11H2,(H,12,13)/t5-,6+/m1/s1 |
| InChIKey | CNUIJQNDUWSXQB-RITPCOANSA-N |
| XLogP | -1.39 |
| TPSA | 141.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|