C8H16N2O3S — CID 87308343
(2S)-2-amino-4-methylsulfanylbutanoic acid;prop-2-enamide (PubChem CID 87308343) has the molecular formula C8H16N2O3S and a molecular weight of 220.29 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanylbutanoic acid;prop-2-enamide.
| Compound Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;prop-2-enamide |
|---|---|
| PubChem CID | 87308343 |
| Molecular Formula | C8H16N2O3S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;prop-2-enamide |
| SMILES | C=CC(N)=O.CSCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H11NO2S.C3H5NO/c1-9-3-2-4(6)5(7)8;1-2-3(4)5/h4H,2-3,6H2,1H3,(H,7,8);2H,1H2,(H2,4,5)/t4-;/m0./s1 |
| InChIKey | MWIWHUIRKQHVTB-WCCKRBBISA-N |
| XLogP | -0.19 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|