C9H16N2O7S2 — CID 23088926
2-amino-3-[[2-carboxy-2-(2,3-dihydroxypropanoylamino)ethyl]disulfanyl]propanoic acid (PubChem CID 23088926) has the molecular formula C9H16N2O7S2 and a molecular weight of 328.37 g/mol. Its IUPAC name is 2-amino-3-[[2-carboxy-2-(2,3-dihydroxypropanoylamino)ethyl]disulfanyl]propanoic acid.
| Compound Name | 2-amino-3-[[2-carboxy-2-(2,3-dihydroxypropanoylamino)ethyl]disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 23088926 |
| Molecular Formula | C9H16N2O7S2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-amino-3-[[2-carboxy-2-(2,3-dihydroxypropanoylamino)ethyl]disulfanyl]propanoic acid |
| SMILES | NC(CSSCC(NC(=O)C(O)CO)C(=O)O)C(=O)O |
| InChI | InChI=1S/C9H16N2O7S2/c10-4(8(15)16)2-19-20-3-5(9(17)18)11-7(14)6(13)1-12/h4-6,12-13H,1-3,10H2,(H,11,14)(H,15,16)(H,17,18) |
| InChIKey | QAADFHZZWYBNFF-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 170.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|