C18H34N4O6S2 — CID 23424270
2-[(2-amino-3,3-dimethylbutanoyl)amino]-3-[[2-[(2-amino-3,3-dimethylbutanoyl)amino]-2-carboxyethyl]disulfanyl]propanoic acid (PubChem CID 23424270) has the molecular formula C18H34N4O6S2 and a molecular weight of 466.63 g/mol. Its IUPAC name is 2-[(2-amino-3,3-dimethylbutanoyl)amino]-3-[[2-[(2-amino-3,3-dimethylbutanoyl)amino]-2-carboxyethyl]disulfanyl]propanoic acid.
| Compound Name | 2-[(2-amino-3,3-dimethylbutanoyl)amino]-3-[[2-[(2-amino-3,3-dimethylbutanoyl)amino]-2-carboxyethyl]disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 23424270 |
| Molecular Formula | C18H34N4O6S2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 2-[(2-amino-3,3-dimethylbutanoyl)amino]-3-[[2-[(2-amino-3,3-dimethylbutanoyl)amino]-2-carboxyethyl]disulfanyl]propanoic acid |
| SMILES | CC(C)(C)C(N)C(=O)NC(CSSCC(NC(=O)C(N)C(C)(C)C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C18H34N4O6S2/c1-17(2,3)11(19)13(23)21-9(15(25)26)7-29-30-8-10(16(27)28)22-14(24)12(20)18(4,5)6/h9-12H,7-8,19-20H2,1-6H3,(H,21,23)(H,22,24)(H,25,26)(H,27,28) |
| InChIKey | GBNFPCVLMYXNBD-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 184.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|