C16H28N6O8S2 — CID 54316714
2-amino-3-[[(2R)-2-[[(2S)-5-amino-2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]-5-oxopentanoyl]amino]-2-carboxyethyl]disulfanyl]propanoic acid (PubChem CID 54316714) has the molecular formula C16H28N6O8S2 and a molecular weight of 496.57 g/mol. Its IUPAC name is 2-amino-3-[[(2R)-2-[[(2S)-5-amino-2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]-5-oxopentanoyl]amino]-2-carboxyethyl]disulfanyl]propanoic acid.
| Compound Name | 2-amino-3-[[(2R)-2-[[(2S)-5-amino-2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]-5-oxopentanoyl]amino]-2-carboxyethyl]disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 54316714 |
| Molecular Formula | C16H28N6O8S2 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 2-amino-3-[[(2R)-2-[[(2S)-5-amino-2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]-5-oxopentanoyl]amino]-2-carboxyethyl]disulfanyl]propanoic acid |
| SMILES | NC(=O)CC[C@H](NC(=O)[C@@H](N)CCC(N)=O)C(=O)N[C@@H](CSSCC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H28N6O8S2/c17-7(1-3-11(19)23)13(25)21-9(2-4-12(20)24)14(26)22-10(16(29)30)6-32-31-5-8(18)15(27)28/h7-10H,1-6,17-18H2,(H2,19,23)(H2,20,24)(H,21,25)(H,22,26)(H,27,28)(H,29,30)/t7-,8?,9-,10-/m0/s1 |
| InChIKey | SOSOBZZTOQNHGW-HFXXUHSDSA-N |
| XLogP | -3.31 |
| TPSA | 271.02 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|