C19H29N5O12 — CID 18264939
2-[[2-[[5-amino-2-[(2-amino-4-carboxybutanoyl)amino]-5-oxopentanoyl]amino]-4-carboxybutanoyl]amino]butanedioic acid (PubChem CID 18264939) has the molecular formula C19H29N5O12 and a molecular weight of 519.46 g/mol. Its IUPAC name is 2-[[2-[[5-amino-2-[(2-amino-4-carboxybutanoyl)amino]-5-oxopentanoyl]amino]-4-carboxybutanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[5-amino-2-[(2-amino-4-carboxybutanoyl)amino]-5-oxopentanoyl]amino]-4-carboxybutanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18264939 |
| Molecular Formula | C19H29N5O12 |
| Molecular Weight | 519.46 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | 2-[[2-[[5-amino-2-[(2-amino-4-carboxybutanoyl)amino]-5-oxopentanoyl]amino]-4-carboxybutanoyl]amino]butanedioic acid |
| SMILES | NC(=O)CCC(NC(=O)C(N)CCC(=O)O)C(=O)NC(CCC(=O)O)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H29N5O12/c20-8(1-5-13(26)27)16(32)22-9(2-4-12(21)25)17(33)23-10(3-6-14(28)29)18(34)24-11(19(35)36)7-15(30)31/h8-11H,1-7,20H2,(H2,21,25)(H,22,32)(H,23,33)(H,24,34)(H,26,27)(H,28,29)(H,30,31)(H,35,36) |
| InChIKey | JXACICVVDKDXAI-UHFFFAOYSA-N |
| XLogP | -3.68 |
| TPSA | 305.61 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.46 |
| LogP ≤ 5 | -3.68 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |