C18H27N5O12 — CID 18249002
2-[[2-[[5-amino-2-[(2-amino-3-carboxypropanoyl)amino]-5-oxopentanoyl]amino]-4-carboxybutanoyl]amino]butanedioic acid (PubChem CID 18249002) has the molecular formula C18H27N5O12 and a molecular weight of 505.44 g/mol. Its IUPAC name is 2-[[2-[[5-amino-2-[(2-amino-3-carboxypropanoyl)amino]-5-oxopentanoyl]amino]-4-carboxybutanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[5-amino-2-[(2-amino-3-carboxypropanoyl)amino]-5-oxopentanoyl]amino]-4-carboxybutanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18249002 |
| Molecular Formula | C18H27N5O12 |
| Molecular Weight | 505.44 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | 2-[[2-[[5-amino-2-[(2-amino-3-carboxypropanoyl)amino]-5-oxopentanoyl]amino]-4-carboxybutanoyl]amino]butanedioic acid |
| SMILES | NC(=O)CCC(NC(=O)C(N)CC(=O)O)C(=O)NC(CCC(=O)O)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H27N5O12/c19-7(5-13(27)28)15(31)21-8(1-3-11(20)24)16(32)22-9(2-4-12(25)26)17(33)23-10(18(34)35)6-14(29)30/h7-10H,1-6,19H2,(H2,20,24)(H,21,31)(H,22,32)(H,23,33)(H,25,26)(H,27,28)(H,29,30)(H,34,35) |
| InChIKey | ZDTQIXUQQPXMMH-UHFFFAOYSA-N |
| XLogP | -4.07 |
| TPSA | 305.61 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.44 |
| LogP ≤ 5 | -4.07 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |