C14H14N2O5S — CID 22476015
4-amino-2-(naphthalen-1-ylsulfonylamino)-4-oxobutanoic acid (PubChem CID 22476015) has the molecular formula C14H14N2O5S and a molecular weight of 322.34 g/mol. Its IUPAC name is 4-amino-2-(naphthalen-1-ylsulfonylamino)-4-oxobutanoic acid.
| Compound Name | 4-amino-2-(naphthalen-1-ylsulfonylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22476015 |
| Molecular Formula | C14H14N2O5S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 4-amino-2-(naphthalen-1-ylsulfonylamino)-4-oxobutanoic acid |
| SMILES | NC(=O)CC(NS(=O)(=O)c1cccc2ccccc12)C(=O)O |
| InChI | InChI=1S/C14H14N2O5S/c15-13(17)8-11(14(18)19)16-22(20,21)12-7-3-5-9-4-1-2-6-10(9)12/h1-7,11,16H,8H2,(H2,15,17)(H,18,19) |
| InChIKey | JDOIWGDUPKRNOL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |