C18H23NO4S — CID 102208300
2-(naphthalen-1-ylsulfonylamino)octanoic acid (PubChem CID 102208300) has the molecular formula C18H23NO4S and a molecular weight of 349.45 g/mol. Its IUPAC name is 2-(naphthalen-1-ylsulfonylamino)octanoic acid.
| Compound Name | 2-(naphthalen-1-ylsulfonylamino)octanoic acid |
|---|---|
| PubChem CID | 102208300 |
| Molecular Formula | C18H23NO4S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 2-(naphthalen-1-ylsulfonylamino)octanoic acid |
| SMILES | CCCCCCC(NS(=O)(=O)c1cccc2ccccc12)C(=O)O |
| InChI | InChI=1S/C18H23NO4S/c1-2-3-4-5-12-16(18(20)21)19-24(22,23)17-13-8-10-14-9-6-7-11-15(14)17/h6-11,13,16,19H,2-5,12H2,1H3,(H,20,21) |
| InChIKey | KIJPUKWAHUKZRK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|